C20H18ClN5O — CID 166632372
2-chloro-4-[(2-oxo-4-piperidin-1-yl-1H-quinolin-6-yl)amino]pyridine-3-carbonitrile (PubChem CID 166632372) has the molecular formula C20H18ClN5O and a molecular weight of 379.85 g/mol. Its IUPAC name is 2-chloro-4-[(2-oxo-4-piperidin-1-yl-1H-quinolin-6-yl)amino]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-4-[(2-oxo-4-piperidin-1-yl-1H-quinolin-6-yl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166632372 |
| Molecular Formula | C20H18ClN5O |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-chloro-4-[(2-oxo-4-piperidin-1-yl-1H-quinolin-6-yl)amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(Nc2ccc3[nH]c(=O)cc(N4CCCCC4)c3c2)ccnc1Cl |
| InChI | InChI=1S/C20H18ClN5O/c21-20-15(12-22)17(6-7-23-20)24-13-4-5-16-14(10-13)18(11-19(27)25-16)26-8-2-1-3-9-26/h4-7,10-11H,1-3,8-9H2,(H,23,24)(H,25,27) |
| InChIKey | KCUHYCIGBCKRTB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|