C22H22ClN5O2 — CID 166632955
N-[5-[(2-acetamidoethylamino)methyl]-2-pyridinyl]-2-chloro-3-pyridin-4-ylbenzamide (PubChem CID 166632955) has the molecular formula C22H22ClN5O2 and a molecular weight of 423.90 g/mol. Its IUPAC name is N-[5-[(2-acetamidoethylamino)methyl]-2-pyridinyl]-2-chloro-3-pyridin-4-ylbenzamide.
| Compound Name | N-[5-[(2-acetamidoethylamino)methyl]-2-pyridinyl]-2-chloro-3-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 166632955 |
| Molecular Formula | C22H22ClN5O2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-[5-[(2-acetamidoethylamino)methyl]-2-pyridinyl]-2-chloro-3-pyridin-4-ylbenzamide |
| SMILES | CC(=O)NCCNCc1ccc(NC(=O)c2cccc(-c3ccncc3)c2Cl)nc1 |
| InChI | InChI=1S/C22H22ClN5O2/c1-15(29)26-12-11-25-13-16-5-6-20(27-14-16)28-22(30)19-4-2-3-18(21(19)23)17-7-9-24-10-8-17/h2-10,14,25H,11-13H2,1H3,(H,26,29)(H,27,28,30) |
| InChIKey | WCPWMCGDLPXOBN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|