C37H37N5O5S — CID 166633833
N-[2-[3-[[2-methoxy-5-[3-[methyl(pyridin-3-ylmethyl)carbamoyl]phenyl]phenyl]sulfonylamino]anilino]ethyl]-3-methylbenzamide (PubChem CID 166633833) has the molecular formula C37H37N5O5S and a molecular weight of 663.80 g/mol. Its IUPAC name is N-[2-[3-[[2-methoxy-5-[3-[methyl(pyridin-3-ylmethyl)carbamoyl]phenyl]phenyl]sulfonylamino]anilino]ethyl]-3-methylbenzamide.
| Compound Name | N-[2-[3-[[2-methoxy-5-[3-[methyl(pyridin-3-ylmethyl)carbamoyl]phenyl]phenyl]sulfonylamino]anilino]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 166633833 |
| Molecular Formula | C37H37N5O5S |
| Molecular Weight | 663.80 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | N-[2-[3-[[2-methoxy-5-[3-[methyl(pyridin-3-ylmethyl)carbamoyl]phenyl]phenyl]sulfonylamino]anilino]ethyl]-3-methylbenzamide |
| SMILES | COc1ccc(-c2cccc(C(=O)N(C)Cc3cccnc3)c2)cc1S(=O)(=O)Nc1cccc(NCCNC(=O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C37H37N5O5S/c1-26-8-4-11-30(20-26)36(43)40-19-18-39-32-13-6-14-33(23-32)41-48(45,46)35-22-29(15-16-34(35)47-3)28-10-5-12-31(21-28)37(44)42(2)25-27-9-7-17-38-24-27/h4-17,20-24,39,41H,18-19,25H2,1-3H3,(H,40,43) |
| InChIKey | RCIRUDLVTXPQQZ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.80 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|