C28H28N4O5S — CID 122191827
2-methoxy-N-[2-[3-[(2-methoxy-5-pyridin-3-ylphenyl)sulfonylamino]anilino]ethyl]benzamide (PubChem CID 122191827) has the molecular formula C28H28N4O5S and a molecular weight of 532.62 g/mol. Its IUPAC name is 2-methoxy-N-[2-[3-[(2-methoxy-5-pyridin-3-ylphenyl)sulfonylamino]anilino]ethyl]benzamide.
| Compound Name | 2-methoxy-N-[2-[3-[(2-methoxy-5-pyridin-3-ylphenyl)sulfonylamino]anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 122191827 |
| Molecular Formula | C28H28N4O5S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 2-methoxy-N-[2-[3-[(2-methoxy-5-pyridin-3-ylphenyl)sulfonylamino]anilino]ethyl]benzamide |
| SMILES | COc1ccccc1C(=O)NCCNc1cccc(NS(=O)(=O)c2cc(-c3cccnc3)ccc2OC)c1 |
| InChI | InChI=1S/C28H28N4O5S/c1-36-25-11-4-3-10-24(25)28(33)31-16-15-30-22-8-5-9-23(18-22)32-38(34,35)27-17-20(12-13-26(27)37-2)21-7-6-14-29-19-21/h3-14,17-19,30,32H,15-16H2,1-2H3,(H,31,33) |
| InChIKey | MLEYFDJNWQGHCP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|