C25H27N3O4S — CID 3622154
2-ethoxy-N-[4-(2-pyridin-3-ylpiperidin-1-yl)sulfonylphenyl]benzamide (PubChem CID 3622154) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is 2-ethoxy-N-[4-(2-pyridin-3-ylpiperidin-1-yl)sulfonylphenyl]benzamide.
| Compound Name | 2-ethoxy-N-[4-(2-pyridin-3-ylpiperidin-1-yl)sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 3622154 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-ethoxy-N-[4-(2-pyridin-3-ylpiperidin-1-yl)sulfonylphenyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)Nc1ccc(S(=O)(=O)N2CCCCC2c2cccnc2)cc1 |
| InChI | InChI=1S/C25H27N3O4S/c1-2-32-24-11-4-3-9-22(24)25(29)27-20-12-14-21(15-13-20)33(30,31)28-17-6-5-10-23(28)19-8-7-16-26-18-19/h3-4,7-9,11-16,18,23H,2,5-6,10,17H2,1H3,(H,27,29) |
| InChIKey | LPGMUGZGLZBKJT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |