C17H19N3O2 — CID 166634302
4-(1-benzofuran-5-yl)-6-N-(3-methoxypropyl)pyridine-2,6-diamine (PubChem CID 166634302) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-(1-benzofuran-5-yl)-6-N-(3-methoxypropyl)pyridine-2,6-diamine.
| Compound Name | 4-(1-benzofuran-5-yl)-6-N-(3-methoxypropyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 166634302 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-(1-benzofuran-5-yl)-6-N-(3-methoxypropyl)pyridine-2,6-diamine |
| SMILES | COCCCNc1cc(-c2ccc3occc3c2)cc(N)n1 |
| InChI | InChI=1S/C17H19N3O2/c1-21-7-2-6-19-17-11-14(10-16(18)20-17)12-3-4-15-13(9-12)5-8-22-15/h3-5,8-11H,2,6-7H2,1H3,(H3,18,19,20) |
| InChIKey | WJPAALSMUAZBSF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|