C25H25N3O3 — CID 166635387
N-benzyl-4-[(1-methylindol-5-yl)-prop-2-ynoylamino]oxane-4-carboxamide (PubChem CID 166635387) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-benzyl-4-[(1-methylindol-5-yl)-prop-2-ynoylamino]oxane-4-carboxamide.
| Compound Name | N-benzyl-4-[(1-methylindol-5-yl)-prop-2-ynoylamino]oxane-4-carboxamide |
|---|---|
| PubChem CID | 166635387 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-benzyl-4-[(1-methylindol-5-yl)-prop-2-ynoylamino]oxane-4-carboxamide |
| SMILES | C#CC(=O)N(c1ccc2c(ccn2C)c1)C1(C(=O)NCc2ccccc2)CCOCC1 |
| InChI | InChI=1S/C25H25N3O3/c1-3-23(29)28(21-9-10-22-20(17-21)11-14-27(22)2)25(12-15-31-16-13-25)24(30)26-18-19-7-5-4-6-8-19/h1,4-11,14,17H,12-13,15-16,18H2,2H3,(H,26,30) |
| InChIKey | COEXPXJYMOAWPI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|