C19H16BrNO5S — CID 166635591
3-[4-[(4-bromophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]propanoic acid (PubChem CID 166635591) has the molecular formula C19H16BrNO5S and a molecular weight of 450.31 g/mol. Its IUPAC name is 3-[4-[(4-bromophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]propanoic acid.
| Compound Name | 3-[4-[(4-bromophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 166635591 |
| Molecular Formula | C19H16BrNO5S |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | 3-[4-[(4-bromophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1cc(NS(=O)(=O)c2ccc(Br)cc2)c2ccccc2c1O |
| InChI | InChI=1S/C19H16BrNO5S/c20-13-6-8-14(9-7-13)27(25,26)21-17-11-12(5-10-18(22)23)19(24)16-4-2-1-3-15(16)17/h1-4,6-9,11,21,24H,5,10H2,(H,22,23) |
| InChIKey | ALLMKXCUURSYGS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|