C23H23FN6O5S — CID 166636154
1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(4-sulfamoylphenyl)diazenyl]piperazin-1-yl]quinoline-3-carboxylic acid (PubChem CID 166636154) has the molecular formula C23H23FN6O5S and a molecular weight of 514.54 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(4-sulfamoylphenyl)diazenyl]piperazin-1-yl]quinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(4-sulfamoylphenyl)diazenyl]piperazin-1-yl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 166636154 |
| Molecular Formula | C23H23FN6O5S |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(4-sulfamoylphenyl)diazenyl]piperazin-1-yl]quinoline-3-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(/N=N/N2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4C3CC3)CC2)cc1 |
| InChI | InChI=1S/C23H23FN6O5S/c24-19-11-17-20(30(15-3-4-15)13-18(22(17)31)23(32)33)12-21(19)28-7-9-29(10-8-28)27-26-14-1-5-16(6-2-14)36(25,34)35/h1-2,5-6,11-13,15H,3-4,7-10H2,(H,32,33)(H2,25,34,35)/b27-26+ |
| InChIKey | ABMLCXHASODBAT-CYYJNZCTSA-N |
| XLogP | 2.64 |
| TPSA | 150.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|