About bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate
bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate (PubChem CID 166637546) has the molecular formula C20H26N4O6
and a molecular weight of 418.45 g/mol. Its IUPAC name is bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate.
Molecular Properties
| Compound Name | bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate |
| PubChem CID | 166637546 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate |
| SMILES | Cc1cc(C)n(CCOC(=O)CCC(=O)OCCn2c(C)cc(C)nc2=O)c(=O)n1 |
| InChI | InChI=1S/C20H26N4O6/c1-13-11-15(3)23(19(27)21-13)7-9-29-17(25)5-6-18(26)30-10-8-24-16(4)12-14(2)22-20(24)28/h11-12H,5-10H2,1-4H3 |
| InChIKey | BPCMRXXDJYZZNQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 122.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate?
The IUPAC name of bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate (CID 166637546) is bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate.
What is the SMILES notation for bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate?
The canonical SMILES for bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate is Cc1cc(C)n(CCOC(=O)CCC(=O)OCCn2c(C)cc(C)nc2=O)c(=O)n1.
What is the InChIKey of bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate?
The InChIKey is BPCMRXXDJYZZNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O6/c1-13-11-15(3)23(19(27)21-13)7-9-29-17(25)5-6-18(26)30-10-8-24-16(4)12-14(2)22-20(24)28/h11-12H,5-10H2,1-4H3.
What are the key properties of bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate?
bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate has a molecular weight of 418.45 g/mol, XLogP of 0.60, 9 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] butanedioate is sourced from PubChem (CID 166637546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).