About bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate
bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate (PubChem CID 166637560) has the molecular formula C22H30N4O6
and a molecular weight of 446.50 g/mol. Its IUPAC name is bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate.
Molecular Properties
| Compound Name | bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate |
| PubChem CID | 166637560 |
| Molecular Formula | C22H30N4O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate |
| SMILES | Cc1cc(C)n(CCOC(=O)CCCCC(=O)OCCn2c(C)cc(C)nc2=O)c(=O)n1 |
| InChI | InChI=1S/C22H30N4O6/c1-15-13-17(3)25(21(29)23-15)9-11-31-19(27)7-5-6-8-20(28)32-12-10-26-18(4)14-16(2)24-22(26)30/h13-14H,5-12H2,1-4H3 |
| InChIKey | GLVIIXNOSMGKKG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 122.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate?
The IUPAC name of bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate (CID 166637560) is bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate.
What is the SMILES notation for bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate?
The canonical SMILES for bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate is Cc1cc(C)n(CCOC(=O)CCCCC(=O)OCCn2c(C)cc(C)nc2=O)c(=O)n1.
What is the InChIKey of bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate?
The InChIKey is GLVIIXNOSMGKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N4O6/c1-15-13-17(3)25(21(29)23-15)9-11-31-19(27)7-5-6-8-20(28)32-12-10-26-18(4)14-16(2)24-22(26)30/h13-14H,5-12H2,1-4H3.
What are the key properties of bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate?
bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate has a molecular weight of 446.50 g/mol, XLogP of 1.38, 11 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] hexanedioate is sourced from PubChem (CID 166637560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).