About bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate
bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate (PubChem CID 166637571) has the molecular formula C24H34N4O6
and a molecular weight of 474.56 g/mol. Its IUPAC name is bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate.
Molecular Properties
| Compound Name | bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate |
| PubChem CID | 166637571 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate |
| SMILES | Cc1cc(C)n(CCOC(=O)CCCCCCC(=O)OCCn2c(C)cc(C)nc2=O)c(=O)n1 |
| InChI | InChI=1S/C24H34N4O6/c1-17-15-19(3)27(23(31)25-17)11-13-33-21(29)9-7-5-6-8-10-22(30)34-14-12-28-20(4)16-18(2)26-24(28)32/h15-16H,5-14H2,1-4H3 |
| InChIKey | SAOKLQQNQRJHTN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 122.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate?
The IUPAC name of bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate (CID 166637571) is bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate.
What is the SMILES notation for bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate?
The canonical SMILES for bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate is Cc1cc(C)n(CCOC(=O)CCCCCCC(=O)OCCn2c(C)cc(C)nc2=O)c(=O)n1.
What is the InChIKey of bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate?
The InChIKey is SAOKLQQNQRJHTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N4O6/c1-17-15-19(3)27(23(31)25-17)11-13-33-21(29)9-7-5-6-8-10-22(30)34-14-12-28-20(4)16-18(2)26-24(28)32/h15-16H,5-14H2,1-4H3.
What are the key properties of bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate?
bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate has a molecular weight of 474.56 g/mol, XLogP of 2.16, 13 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] octanedioate is sourced from PubChem (CID 166637571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).