C11H8F6O3 — CID 166641134
3-[2,5-bis(trifluoromethoxy)phenyl]propanal (PubChem CID 166641134) has the molecular formula C11H8F6O3 and a molecular weight of 302.17 g/mol. Its IUPAC name is 3-[2,5-bis(trifluoromethoxy)phenyl]propanal.
| Compound Name | 3-[2,5-bis(trifluoromethoxy)phenyl]propanal |
|---|---|
| PubChem CID | 166641134 |
| Molecular Formula | C11H8F6O3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3-[2,5-bis(trifluoromethoxy)phenyl]propanal |
| SMILES | O=CCCc1cc(OC(F)(F)F)ccc1OC(F)(F)F |
| InChI | InChI=1S/C11H8F6O3/c12-10(13,14)19-8-3-4-9(20-11(15,16)17)7(6-8)2-1-5-18/h3-6H,1-2H2 |
| InChIKey | DUUJKQPYQULHNW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|