C10H6F6O4 — CID 87851559
[2,5-bis(trifluoromethoxy)phenyl]methyl formate (PubChem CID 87851559) has the molecular formula C10H6F6O4 and a molecular weight of 304.14 g/mol. Its IUPAC name is [2,5-bis(trifluoromethoxy)phenyl]methyl formate.
| Compound Name | [2,5-bis(trifluoromethoxy)phenyl]methyl formate |
|---|---|
| PubChem CID | 87851559 |
| Molecular Formula | C10H6F6O4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | [2,5-bis(trifluoromethoxy)phenyl]methyl formate |
| SMILES | O=COCc1cc(OC(F)(F)F)ccc1OC(F)(F)F |
| InChI | InChI=1S/C10H6F6O4/c11-9(12,13)19-7-1-2-8(20-10(14,15)16)6(3-7)4-18-5-17/h1-3,5H,4H2 |
| InChIKey | MFNYANSUGDWBJW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|