C20H24N4O2S — CID 16664467
3-[[[3-(benzylamino)-3-oxopropyl]carbamothioylamino]methyl]-N-methylbenzamide (PubChem CID 16664467) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 3-[[[3-(benzylamino)-3-oxopropyl]carbamothioylamino]methyl]-N-methylbenzamide.
| Compound Name | 3-[[[3-(benzylamino)-3-oxopropyl]carbamothioylamino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 16664467 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 3-[[[3-(benzylamino)-3-oxopropyl]carbamothioylamino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(CNC(=S)NCCC(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C20H24N4O2S/c1-21-19(26)17-9-5-8-16(12-17)14-24-20(27)22-11-10-18(25)23-13-15-6-3-2-4-7-15/h2-9,12H,10-11,13-14H2,1H3,(H,21,26)(H,23,25)(H2,22,24,27) |
| InChIKey | YKNIXIMVPPCPJF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|