C22H23N3O3 — CID 55690441
N-methyl-3-[[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]methyl]benzamide (PubChem CID 55690441) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-methyl-3-[[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]methyl]benzamide.
| Compound Name | N-methyl-3-[[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 55690441 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-methyl-3-[[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]methyl]benzamide |
| SMILES | CNC(=O)c1cccc(CNC(=O)CCCc2ncc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C22H23N3O3/c1-23-22(27)18-10-5-7-16(13-18)14-24-20(26)11-6-12-21-25-15-19(28-21)17-8-3-2-4-9-17/h2-5,7-10,13,15H,6,11-12,14H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | JBJBHJCNGVSHCH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |