C22H20F3N3O3 — CID 38937435
3-[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 38937435) has the molecular formula C22H20F3N3O3 and a molecular weight of 431.41 g/mol. Its IUPAC name is 3-[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 38937435 |
| Molecular Formula | C22H20F3N3O3 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-[4-(5-phenyl-1,3-oxazol-2-yl)butanoylamino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(CCCc1ncc(-c2ccccc2)o1)Nc1cccc(C(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F3N3O3/c23-22(24,25)14-27-21(30)16-8-4-9-17(12-16)28-19(29)10-5-11-20-26-13-18(31-20)15-6-2-1-3-7-15/h1-4,6-9,12-13H,5,10-11,14H2,(H,27,30)(H,28,29) |
| InChIKey | PSEFEMHNOQLQOM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |