C25H34N8O4 — CID 166646839
7-[3-[[2-(dimethylamino)acetyl]amino]propoxy]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-prop-2-enylbenzimidazole-5-carboxamide (PubChem CID 166646839) has the molecular formula C25H34N8O4 and a molecular weight of 510.60 g/mol. Its IUPAC name is 7-[3-[[2-(dimethylamino)acetyl]amino]propoxy]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-prop-2-enylbenzimidazole-5-carboxamide.
| Compound Name | 7-[3-[[2-(dimethylamino)acetyl]amino]propoxy]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-prop-2-enylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 166646839 |
| Molecular Formula | C25H34N8O4 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 7-[3-[[2-(dimethylamino)acetyl]amino]propoxy]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1-prop-2-enylbenzimidazole-5-carboxamide |
| SMILES | C=CCn1c(NC(=O)c2cc(C)nn2CC)nc2cc(C(N)=O)cc(OCCCNC(=O)CN(C)C)c21 |
| InChI | InChI=1S/C25H34N8O4/c1-6-10-32-22-18(28-25(32)29-24(36)19-12-16(3)30-33(19)7-2)13-17(23(26)35)14-20(22)37-11-8-9-27-21(34)15-31(4)5/h6,12-14H,1,7-11,15H2,2-5H3,(H2,26,35)(H,27,34)(H,28,29,36) |
| InChIKey | CYKLBGZXHXENND-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 149.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|