C46H35N5 — CID 166647626
9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-methyl-3,4,5,6-tetrahydrocarbazol-9-yl)phenyl]carbazole (PubChem CID 166647626) has the molecular formula C46H35N5 and a molecular weight of 657.82 g/mol. Its IUPAC name is 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-methyl-3,4,5,6-tetrahydrocarbazol-9-yl)phenyl]carbazole.
| Compound Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-methyl-3,4,5,6-tetrahydrocarbazol-9-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 166647626 |
| Molecular Formula | C46H35N5 |
| Molecular Weight | 657.82 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-methyl-3,4,5,6-tetrahydrocarbazol-9-yl)phenyl]carbazole |
| SMILES | CC1CC=Cc2c1c1c(n2-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-n3c4ccccc4c4ccccc43)c2)C=CCC1 |
| InChI | InChI=1S/C46H35N5/c1-30-15-14-26-42-43(30)38-22-10-13-25-41(38)51(42)35-28-33(27-34(29-35)50-39-23-11-8-20-36(39)37-21-9-12-24-40(37)50)46-48-44(31-16-4-2-5-17-31)47-45(49-46)32-18-6-3-7-19-32/h2-9,11-14,16-21,23-30H,10,15,22H2,1H3 |
| InChIKey | MFWIVDODAHHVJF-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.82 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |