C21H32O2 — CID 166648861
(1R,2S,5R,7R,10S,11S,16S)-11-methyl-5-propan-2-yl-6-oxapentacyclo[8.8.0.02,7.05,7.011,16]octadecan-14-one (PubChem CID 166648861) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (1R,2S,5R,7R,10S,11S,16S)-11-methyl-5-propan-2-yl-6-oxapentacyclo[8.8.0.02,7.05,7.011,16]octadecan-14-one.
| Compound Name | (1R,2S,5R,7R,10S,11S,16S)-11-methyl-5-propan-2-yl-6-oxapentacyclo[8.8.0.02,7.05,7.011,16]octadecan-14-one |
|---|---|
| PubChem CID | 166648861 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (1R,2S,5R,7R,10S,11S,16S)-11-methyl-5-propan-2-yl-6-oxapentacyclo[8.8.0.02,7.05,7.011,16]octadecan-14-one |
| SMILES | CC(C)[C@]12CC[C@H]3[C@@H]4CC[C@H]5CC(=O)CC[C@]5(C)[C@H]4CC[C@@]31O2 |
| InChI | InChI=1S/C21H32O2/c1-13(2)20-10-8-18-16-5-4-14-12-15(22)6-9-19(14,3)17(16)7-11-21(18,20)23-20/h13-14,16-18H,4-12H2,1-3H3/t14-,16+,17-,18-,19-,20+,21+/m0/s1 |
| InChIKey | RNTOJXQWAXIAKC-GXLOBQEZSA-N |
| XLogP | 4.76 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|