C24H46O2 — CID 156740871
(4aS,7R,8aS)-4a,7-dimethyl-7-propan-2-yl-8-propyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-1H-phenanthren-2-one;methane;methanol (PubChem CID 156740871) has the molecular formula C24H46O2 and a molecular weight of 366.63 g/mol. Its IUPAC name is (4aS,7R,8aS)-4a,7-dimethyl-7-propan-2-yl-8-propyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-1H-phenanthren-2-one;methane;methanol.
| Compound Name | (4aS,7R,8aS)-4a,7-dimethyl-7-propan-2-yl-8-propyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-1H-phenanthren-2-one;methane;methanol |
|---|---|
| PubChem CID | 156740871 |
| Molecular Formula | C24H46O2 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.35 |
| IUPAC Name | (4aS,7R,8aS)-4a,7-dimethyl-7-propan-2-yl-8-propyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-1H-phenanthren-2-one;methane;methanol |
| SMILES | C.CCCC1[C@@H]2CCC3CC(=O)CC[C@]3(C)C2CC[C@]1(C)C(C)C.CO |
| InChI | InChI=1S/C22H38O.CH4O.CH4/c1-6-7-19-18-9-8-16-14-17(23)10-12-22(16,5)20(18)11-13-21(19,4)15(2)3;1-2;/h15-16,18-20H,6-14H2,1-5H3;2H,1H3;1H4/t16?,18-,19?,20?,21+,22-;;/m0../s1 |
| InChIKey | DRUTUOUQDYXAGL-RGSXXVEYSA-N |
| XLogP | 6.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |