About (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine
(Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine (PubChem CID 166649643) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine.
Molecular Properties
| Compound Name | (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine |
| PubChem CID | 166649643 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine |
| SMILES | C=C(/C=C\CCC)C(C)CN(C)CCCCOC |
| InChI | InChI=1S/C16H31NO/c1-6-7-8-11-15(2)16(3)14-17(4)12-9-10-13-18-5/h8,11,16H,2,6-7,9-10,12-14H2,1,3-5H3/b11-8- |
| InChIKey | TUVYIITZPLWHDF-FLIBITNWSA-N |
| XLogP | 3.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine?
The IUPAC name of (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine (CID 166649643) is (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine.
What is the SMILES notation for (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine?
The canonical SMILES for (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine is C=C(/C=C\CCC)C(C)CN(C)CCCCOC.
What is the InChIKey of (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine?
The InChIKey is TUVYIITZPLWHDF-FLIBITNWSA-N. The full InChI is InChI=1S/C16H31NO/c1-6-7-8-11-15(2)16(3)14-17(4)12-9-10-13-18-5/h8,11,16H,2,6-7,9-10,12-14H2,1,3-5H3/b11-8-.
What are the key properties of (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine?
(Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine has a molecular weight of 253.43 g/mol, XLogP of 3.89, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(4-methoxybutyl)-N,2-dimethyl-3-methylideneoct-4-en-1-amine is sourced from PubChem (CID 166649643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).