C13H24N2O — CID 143265068
(E)-N-(2-methoxyethyl)-N,2,3-trimethyl-4-(prop-2-enylideneamino)but-3-en-1-amine (PubChem CID 143265068) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (E)-N-(2-methoxyethyl)-N,2,3-trimethyl-4-(prop-2-enylideneamino)but-3-en-1-amine.
| Compound Name | (E)-N-(2-methoxyethyl)-N,2,3-trimethyl-4-(prop-2-enylideneamino)but-3-en-1-amine |
|---|---|
| PubChem CID | 143265068 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (E)-N-(2-methoxyethyl)-N,2,3-trimethyl-4-(prop-2-enylideneamino)but-3-en-1-amine |
| SMILES | C=C/C=N/C=C(\C)C(C)CN(C)CCOC |
| InChI | InChI=1S/C13H24N2O/c1-6-7-14-10-12(2)13(3)11-15(4)8-9-16-5/h6-7,10,13H,1,8-9,11H2,2-5H3/b12-10+,14-7+ |
| InChIKey | MZSUTQKMJWPTIB-FEYAHQNISA-N |
| XLogP | 2.36 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|