C19H20F3NO — CID 166650412
(2R,4S)-2-methyl-1-(4-methylphenyl)-4-[4-(trifluoromethyl)phenoxy]pyrrolidine (PubChem CID 166650412) has the molecular formula C19H20F3NO and a molecular weight of 335.37 g/mol. Its IUPAC name is (2R,4S)-2-methyl-1-(4-methylphenyl)-4-[4-(trifluoromethyl)phenoxy]pyrrolidine.
| Compound Name | (2R,4S)-2-methyl-1-(4-methylphenyl)-4-[4-(trifluoromethyl)phenoxy]pyrrolidine |
|---|---|
| PubChem CID | 166650412 |
| Molecular Formula | C19H20F3NO |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (2R,4S)-2-methyl-1-(4-methylphenyl)-4-[4-(trifluoromethyl)phenoxy]pyrrolidine |
| SMILES | Cc1ccc(N2C[C@@H](Oc3ccc(C(F)(F)F)cc3)C[C@H]2C)cc1 |
| InChI | InChI=1S/C19H20F3NO/c1-13-3-7-16(8-4-13)23-12-18(11-14(23)2)24-17-9-5-15(6-10-17)19(20,21)22/h3-10,14,18H,11-12H2,1-2H3/t14-,18+/m1/s1 |
| InChIKey | DDWYWQVCZISQJX-KDOFPFPSSA-N |
| XLogP | 5.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|