C16H25N3O5 — CID 166651867
[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-ylidene]amino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 166651867) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is [[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-ylidene]amino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate.
| Compound Name | [[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-ylidene]amino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 166651867 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | [[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-ylidene]amino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | CC1=NOC(C)(C(=O)ON=C2CCN(C(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C16H25N3O5/c1-11-10-16(5,24-17-11)13(20)23-18-12-6-8-19(9-7-12)14(21)22-15(2,3)4/h6-10H2,1-5H3 |
| InChIKey | PRHWHAUQEHARST-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 89.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|