C18H19F2N5O3 — CID 166651953
(E,2E)-3-(difluoromethoxy)-N-[[3-(2-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-[(methylideneamino)methylidene]pent-3-enamide (PubChem CID 166651953) has the molecular formula C18H19F2N5O3 and a molecular weight of 391.38 g/mol. Its IUPAC name is (E,2E)-3-(difluoromethoxy)-N-[[3-(2-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-[(methylideneamino)methylidene]pent-3-enamide.
| Compound Name | (E,2E)-3-(difluoromethoxy)-N-[[3-(2-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-[(methylideneamino)methylidene]pent-3-enamide |
|---|---|
| PubChem CID | 166651953 |
| Molecular Formula | C18H19F2N5O3 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (E,2E)-3-(difluoromethoxy)-N-[[3-(2-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-[(methylideneamino)methylidene]pent-3-enamide |
| SMILES | C=N/C=C(C(=O)NCc1nc(-c2ccccc2OC)n[nH]1)\C(=C/C)OC(F)F |
| InChI | InChI=1S/C18H19F2N5O3/c1-4-13(28-18(19)20)12(9-21-2)17(26)22-10-15-23-16(25-24-15)11-7-5-6-8-14(11)27-3/h4-9,18H,2,10H2,1,3H3,(H,22,26)(H,23,24,25)/b12-9+,13-4+ |
| InChIKey | RXUUMFILPQQTBD-DDZDXWSVSA-N |
| XLogP | 2.82 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|