C22H32N2 — CID 166657713
4-[4-(cyclohexen-1-yl)cyclohexyl]-1,2,3,3a,4a,8a-hexahydropyrrolo[1,2-a]benzimidazole (PubChem CID 166657713) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 4-[4-(cyclohexen-1-yl)cyclohexyl]-1,2,3,3a,4a,8a-hexahydropyrrolo[1,2-a]benzimidazole.
| Compound Name | 4-[4-(cyclohexen-1-yl)cyclohexyl]-1,2,3,3a,4a,8a-hexahydropyrrolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 166657713 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 4-[4-(cyclohexen-1-yl)cyclohexyl]-1,2,3,3a,4a,8a-hexahydropyrrolo[1,2-a]benzimidazole |
| SMILES | C1=CC2C(C=C1)N(C1CCC(C3=CCCCC3)CC1)C1CCCN21 |
| InChI | InChI=1S/C22H32N2/c1-2-7-17(8-3-1)18-12-14-19(15-13-18)24-21-10-5-4-9-20(21)23-16-6-11-22(23)24/h4-5,7,9-10,18-22H,1-3,6,8,11-16H2 |
| InChIKey | NKNBMRMOQZDZFK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|