C37H65NO4 — CID 166658868
[(3S,10R,13R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[bis[(2R)-2-hydroxypropyl]amino]butanoate (PubChem CID 166658868) has the molecular formula C37H65NO4 and a molecular weight of 587.93 g/mol. Its IUPAC name is [(3S,10R,13R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[bis[(2R)-2-hydroxypropyl]amino]butanoate.
| Compound Name | [(3S,10R,13R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[bis[(2R)-2-hydroxypropyl]amino]butanoate |
|---|---|
| PubChem CID | 166658868 |
| Molecular Formula | C37H65NO4 |
| Molecular Weight | 587.93 g/mol |
| Exact Mass | 587.49 |
| IUPAC Name | [(3S,10R,13R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[bis[(2R)-2-hydroxypropyl]amino]butanoate |
| SMILES | CC(C)CCCC(C)[C@H]1CCC2C3CC=C4C[C@@H](OC(=O)CCCN(C[C@@H](C)O)C[C@@H](C)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C37H65NO4/c1-25(2)10-8-11-26(3)32-15-16-33-31-14-13-29-22-30(17-19-36(29,6)34(31)18-20-37(32,33)7)42-35(41)12-9-21-38(23-27(4)39)24-28(5)40/h13,25-28,30-34,39-40H,8-12,14-24H2,1-7H3/t26?,27-,28-,30+,31?,32-,33?,34?,36+,37-/m1/s1 |
| InChIKey | LDCABLQIALIACX-PUEMDAEESA-N |
| XLogP | 7.78 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.93 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|