C13H24N4O4 — CID 166660807
2-[ethyl-[2-[[2-(methylamino)-2-oxoethyl]-(2-oxoethyl)amino]propyl]amino]-N-formylacetamide (PubChem CID 166660807) has the molecular formula C13H24N4O4 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[ethyl-[2-[[2-(methylamino)-2-oxoethyl]-(2-oxoethyl)amino]propyl]amino]-N-formylacetamide.
| Compound Name | 2-[ethyl-[2-[[2-(methylamino)-2-oxoethyl]-(2-oxoethyl)amino]propyl]amino]-N-formylacetamide |
|---|---|
| PubChem CID | 166660807 |
| Molecular Formula | C13H24N4O4 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-[ethyl-[2-[[2-(methylamino)-2-oxoethyl]-(2-oxoethyl)amino]propyl]amino]-N-formylacetamide |
| SMILES | CCN(CC(=O)NC=O)CC(C)N(CC=O)CC(=O)NC |
| InChI | InChI=1S/C13H24N4O4/c1-4-16(8-13(21)15-10-19)7-11(2)17(5-6-18)9-12(20)14-3/h6,10-11H,4-5,7-9H2,1-3H3,(H,14,20)(H,15,19,21) |
| InChIKey | JWSPCYGKJJATJM-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|