C10H16N2O2 — CID 166660871
4,4-dimethyl-3-pyrazol-1-ylpentanoic acid (PubChem CID 166660871) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4,4-dimethyl-3-pyrazol-1-ylpentanoic acid.
| Compound Name | 4,4-dimethyl-3-pyrazol-1-ylpentanoic acid |
|---|---|
| PubChem CID | 166660871 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4,4-dimethyl-3-pyrazol-1-ylpentanoic acid |
| SMILES | CC(C)(C)C(CC(=O)O)n1cccn1 |
| InChI | InChI=1S/C10H16N2O2/c1-10(2,3)8(7-9(13)14)12-6-4-5-11-12/h4-6,8H,7H2,1-3H3,(H,13,14) |
| InChIKey | FITNVGFBRNAKLV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |