C14H24N2O — CID 166661154
(3Z,5Z)-4-[[1-(dimethylamino)propan-2-ylamino]methyl]octa-3,5,7-trien-2-one (PubChem CID 166661154) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (3Z,5Z)-4-[[1-(dimethylamino)propan-2-ylamino]methyl]octa-3,5,7-trien-2-one.
| Compound Name | (3Z,5Z)-4-[[1-(dimethylamino)propan-2-ylamino]methyl]octa-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 166661154 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (3Z,5Z)-4-[[1-(dimethylamino)propan-2-ylamino]methyl]octa-3,5,7-trien-2-one |
| SMILES | C=C/C=C\C(=C\C(C)=O)CNC(C)CN(C)C |
| InChI | InChI=1S/C14H24N2O/c1-6-7-8-14(9-13(3)17)10-15-12(2)11-16(4)5/h6-9,12,15H,1,10-11H2,2-5H3/b8-7-,14-9- |
| InChIKey | ZZLASPSOCFLZGZ-SIBSCAOJSA-N |
| XLogP | 1.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|