About [3-(oxolan-2-yl)phenyl] thiohypochlorite
[3-(oxolan-2-yl)phenyl] thiohypochlorite (PubChem CID 166661504) has the molecular formula C10H11ClOS
and a molecular weight of 214.72 g/mol. Its IUPAC name is [3-(oxolan-2-yl)phenyl] thiohypochlorite.
Molecular Properties
| Compound Name | [3-(oxolan-2-yl)phenyl] thiohypochlorite |
| PubChem CID | 166661504 |
| Molecular Formula | C10H11ClOS |
| Molecular Weight | 214.72 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | [3-(oxolan-2-yl)phenyl] thiohypochlorite |
| SMILES | ClSc1cccc(C2CCCO2)c1 |
| InChI | InChI=1S/C10H11ClOS/c11-13-9-4-1-3-8(7-9)10-5-2-6-12-10/h1,3-4,7,10H,2,5-6H2 |
| InChIKey | COONQXVTIAUGAB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.72 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(oxolan-2-yl)phenyl] thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(oxolan-2-yl)phenyl] thiohypochlorite?
The IUPAC name of [3-(oxolan-2-yl)phenyl] thiohypochlorite (CID 166661504) is [3-(oxolan-2-yl)phenyl] thiohypochlorite.
What is the SMILES notation for [3-(oxolan-2-yl)phenyl] thiohypochlorite?
The canonical SMILES for [3-(oxolan-2-yl)phenyl] thiohypochlorite is ClSc1cccc(C2CCCO2)c1.
What is the InChIKey of [3-(oxolan-2-yl)phenyl] thiohypochlorite?
The InChIKey is COONQXVTIAUGAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClOS/c11-13-9-4-1-3-8(7-9)10-5-2-6-12-10/h1,3-4,7,10H,2,5-6H2.
What are the key properties of [3-(oxolan-2-yl)phenyl] thiohypochlorite?
[3-(oxolan-2-yl)phenyl] thiohypochlorite has a molecular weight of 214.72 g/mol, XLogP of 3.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(oxolan-2-yl)phenyl] thiohypochlorite is sourced from PubChem (CID 166661504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).