C25H44N4O12 — CID 166661746
(2S,3S,4R)-3-acetamido-4-(1-aminoethenylamino)-2-[(1R,2R)-1-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl-methylcarbamoyl]oxy-2,3-dihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 166661746) has the molecular formula C25H44N4O12 and a molecular weight of 592.64 g/mol. Its IUPAC name is (2S,3S,4R)-3-acetamido-4-(1-aminoethenylamino)-2-[(1R,2R)-1-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl-methylcarbamoyl]oxy-2,3-dihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2S,3S,4R)-3-acetamido-4-(1-aminoethenylamino)-2-[(1R,2R)-1-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl-methylcarbamoyl]oxy-2,3-dihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 166661746 |
| Molecular Formula | C25H44N4O12 |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | (2S,3S,4R)-3-acetamido-4-(1-aminoethenylamino)-2-[(1R,2R)-1-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl-methylcarbamoyl]oxy-2,3-dihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | C=C(N)N[C@@H]1C=C(C(=O)O)O[C@H]([C@H](OC(=O)N(C)CCOCCOCCOCCOCC)[C@H](O)CO)[C@H]1NC(C)=O |
| InChI | InChI=1S/C25H44N4O12/c1-5-36-8-9-38-12-13-39-11-10-37-7-6-29(4)25(35)41-22(19(32)15-30)23-21(28-17(3)31)18(27-16(2)26)14-20(40-23)24(33)34/h14,18-19,21-23,27,30,32H,2,5-13,15,26H2,1,3-4H3,(H,28,31)(H,33,34)/t18-,19-,21+,22-,23+/m1/s1 |
| InChIKey | PNLSZJHTOGBVIH-KRQRVDPASA-N |
| XLogP | -1.88 |
| TPSA | 220.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|