C27H36N4O2 — CID 166663765
3-(2-ethoxyphenyl)-2-[[4-(2-methylpentyl)piperazin-1-yl]methyl]quinazolin-4-one (PubChem CID 166663765) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-2-[[4-(2-methylpentyl)piperazin-1-yl]methyl]quinazolin-4-one.
| Compound Name | 3-(2-ethoxyphenyl)-2-[[4-(2-methylpentyl)piperazin-1-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 166663765 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 3-(2-ethoxyphenyl)-2-[[4-(2-methylpentyl)piperazin-1-yl]methyl]quinazolin-4-one |
| SMILES | CCCC(C)CN1CCN(Cc2nc3ccccc3c(=O)n2-c2ccccc2OCC)CC1 |
| InChI | InChI=1S/C27H36N4O2/c1-4-10-21(3)19-29-15-17-30(18-16-29)20-26-28-23-12-7-6-11-22(23)27(32)31(26)24-13-8-9-14-25(24)33-5-2/h6-9,11-14,21H,4-5,10,15-20H2,1-3H3 |
| InChIKey | OUHIPVLXXULFJV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |