C9H10FN5O6 — CID 16666486
6-azido-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 16666486) has the molecular formula C9H10FN5O6 and a molecular weight of 303.21 g/mol. Its IUPAC name is 6-azido-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 6-azido-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16666486 |
| Molecular Formula | C9H10FN5O6 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 6-azido-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=Nc1c(F)c(=O)[nH]c(=O)n1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H10FN5O6/c10-3-6(13-14-11)15(9(20)12-7(3)19)8-5(18)4(17)2(1-16)21-8/h2,4-5,8,16-18H,1H2,(H,12,19,20)/t2-,4-,5-,8-/m1/s1 |
| InChIKey | JNEQWIQQUJRIQC-UMMCILCDSA-N |
| XLogP | -1.77 |
| TPSA | 173.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|