C28H26ClN5O4 — CID 16666746
N-(5-chloro-2-pyridinyl)-2-[[4-[1-[2-(dimethylamino)ethyl]-2-oxo-3-pyridinyl]benzoyl]amino]-3-hydroxybenzamide (PubChem CID 16666746) has the molecular formula C28H26ClN5O4 and a molecular weight of 532.00 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[4-[1-[2-(dimethylamino)ethyl]-2-oxo-3-pyridinyl]benzoyl]amino]-3-hydroxybenzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[4-[1-[2-(dimethylamino)ethyl]-2-oxo-3-pyridinyl]benzoyl]amino]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 16666746 |
| Molecular Formula | C28H26ClN5O4 |
| Molecular Weight | 532.00 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[4-[1-[2-(dimethylamino)ethyl]-2-oxo-3-pyridinyl]benzoyl]amino]-3-hydroxybenzamide |
| SMILES | CN(C)CCn1cccc(-c2ccc(C(=O)Nc3c(O)cccc3C(=O)Nc3ccc(Cl)cn3)cc2)c1=O |
| InChI | InChI=1S/C28H26ClN5O4/c1-33(2)15-16-34-14-4-6-21(28(34)38)18-8-10-19(11-9-18)26(36)32-25-22(5-3-7-23(25)35)27(37)31-24-13-12-20(29)17-30-24/h3-14,17,35H,15-16H2,1-2H3,(H,32,36)(H,30,31,37) |
| InChIKey | SEWXZNAVXSBHRB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.00 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|