C46H82N2O5 — CID 166667769
1-O-(3-butylhepta-4,5,6-trienyl) 21-O-(3-methylheptyl) 11-[(2-pyrrolidin-1-ylacetyl)amino]henicosanedioate (PubChem CID 166667769) has the molecular formula C46H82N2O5 and a molecular weight of 743.17 g/mol. Its IUPAC name is 1-O-(3-butylhepta-4,5,6-trienyl) 21-O-(3-methylheptyl) 11-[(2-pyrrolidin-1-ylacetyl)amino]henicosanedioate.
| Compound Name | 1-O-(3-butylhepta-4,5,6-trienyl) 21-O-(3-methylheptyl) 11-[(2-pyrrolidin-1-ylacetyl)amino]henicosanedioate |
|---|---|
| PubChem CID | 166667769 |
| Molecular Formula | C46H82N2O5 |
| Molecular Weight | 743.17 g/mol |
| Exact Mass | 742.62 |
| IUPAC Name | 1-O-(3-butylhepta-4,5,6-trienyl) 21-O-(3-methylheptyl) 11-[(2-pyrrolidin-1-ylacetyl)amino]henicosanedioate |
| SMILES | C=C=C=CC(CCCC)CCOC(=O)CCCCCCCCCC(CCCCCCCCCC(=O)OCCC(C)CCCC)NC(=O)CN1CCCC1 |
| InChI | InChI=1S/C46H82N2O5/c1-5-8-27-41(4)34-38-52-45(50)32-23-19-15-11-13-17-21-30-43(47-44(49)40-48-36-25-26-37-48)31-22-18-14-12-16-20-24-33-46(51)53-39-35-42(28-9-6-2)29-10-7-3/h28,41-43H,2,5,7-8,10-27,29-40H2,1,3-4H3,(H,47,49) |
| InChIKey | UYGGSWCECAESEL-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.17 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|