C34H34Cl2N4O10S3 — CID 16666817
[4-[2-(2,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylcarbamoyl)imidazol-1-yl]phenyl] ethanesulfonate;naphthalene-1,5-disulfonic acid (PubChem CID 16666817) has the molecular formula C34H34Cl2N4O10S3 and a molecular weight of 825.77 g/mol. Its IUPAC name is [4-[2-(2,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylcarbamoyl)imidazol-1-yl]phenyl] ethanesulfonate;naphthalene-1,5-disulfonic acid.
| Compound Name | [4-[2-(2,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylcarbamoyl)imidazol-1-yl]phenyl] ethanesulfonate;naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 16666817 |
| Molecular Formula | C34H34Cl2N4O10S3 |
| Molecular Weight | 825.77 g/mol |
| Exact Mass | 824.08 |
| IUPAC Name | [4-[2-(2,4-dichlorophenyl)-5-methyl-4-(piperidin-1-ylcarbamoyl)imidazol-1-yl]phenyl] ethanesulfonate;naphthalene-1,5-disulfonic acid |
| SMILES | CCS(=O)(=O)Oc1ccc(-n2c(-c3ccc(Cl)cc3Cl)nc(C(=O)NN3CCCCC3)c2C)cc1.O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C24H26Cl2N4O4S.C10H8O6S2/c1-3-35(32,33)34-19-10-8-18(9-11-19)30-16(2)22(24(31)28-29-13-5-4-6-14-29)27-23(30)20-12-7-17(25)15-21(20)26;11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h7-12,15H,3-6,13-14H2,1-2H3,(H,28,31);1-6H,(H,11,12,13)(H,14,15,16) |
| InChIKey | SFFQBYWKEACSAC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 202.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.77 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|