C31H34Cl2N4O5S — CID 16667170
2-(2,4-dichlorophenyl)-5-methyl-1-(4-phenylmethoxyphenyl)-N-piperidin-1-ylimidazole-4-carboxamide;ethanesulfonic acid (PubChem CID 16667170) has the molecular formula C31H34Cl2N4O5S and a molecular weight of 645.61 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-methyl-1-(4-phenylmethoxyphenyl)-N-piperidin-1-ylimidazole-4-carboxamide;ethanesulfonic acid.
| Compound Name | 2-(2,4-dichlorophenyl)-5-methyl-1-(4-phenylmethoxyphenyl)-N-piperidin-1-ylimidazole-4-carboxamide;ethanesulfonic acid |
|---|---|
| PubChem CID | 16667170 |
| Molecular Formula | C31H34Cl2N4O5S |
| Molecular Weight | 645.61 g/mol |
| Exact Mass | 644.16 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-methyl-1-(4-phenylmethoxyphenyl)-N-piperidin-1-ylimidazole-4-carboxamide;ethanesulfonic acid |
| SMILES | CCS(=O)(=O)O.Cc1c(C(=O)NN2CCCCC2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H28Cl2N4O2.C2H6O3S/c1-20-27(29(36)33-34-16-6-3-7-17-34)32-28(25-15-10-22(30)18-26(25)31)35(20)23-11-13-24(14-12-23)37-19-21-8-4-2-5-9-21;1-2-6(3,4)5/h2,4-5,8-15,18H,3,6-7,16-17,19H2,1H3,(H,33,36);2H2,1H3,(H,3,4,5) |
| InChIKey | FLNPDLVFTPFYIH-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.61 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|