C26H20Cl4N2O3 — CID 69116105
2,2,2-trichloroethyl 2-(2-chlorophenyl)-5-methyl-1-(4-phenylmethoxyphenyl)imidazole-4-carboxylate (PubChem CID 69116105) has the molecular formula C26H20Cl4N2O3 and a molecular weight of 550.27 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-(2-chlorophenyl)-5-methyl-1-(4-phenylmethoxyphenyl)imidazole-4-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 2-(2-chlorophenyl)-5-methyl-1-(4-phenylmethoxyphenyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 69116105 |
| Molecular Formula | C26H20Cl4N2O3 |
| Molecular Weight | 550.27 g/mol |
| Exact Mass | 548.02 |
| IUPAC Name | 2,2,2-trichloroethyl 2-(2-chlorophenyl)-5-methyl-1-(4-phenylmethoxyphenyl)imidazole-4-carboxylate |
| SMILES | Cc1c(C(=O)OCC(Cl)(Cl)Cl)nc(-c2ccccc2Cl)n1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H20Cl4N2O3/c1-17-23(25(33)35-16-26(28,29)30)31-24(21-9-5-6-10-22(21)27)32(17)19-11-13-20(14-12-19)34-15-18-7-3-2-4-8-18/h2-14H,15-16H2,1H3 |
| InChIKey | DXHUUSLWPPEYSU-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.27 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|