C23H18N2O4 — CID 42581400
4-(2-methyl-4-oxo-6-phenylmethoxyquinazolin-3-yl)benzoic acid (PubChem CID 42581400) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 4-(2-methyl-4-oxo-6-phenylmethoxyquinazolin-3-yl)benzoic acid.
| Compound Name | 4-(2-methyl-4-oxo-6-phenylmethoxyquinazolin-3-yl)benzoic acid |
|---|---|
| PubChem CID | 42581400 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-(2-methyl-4-oxo-6-phenylmethoxyquinazolin-3-yl)benzoic acid |
| SMILES | Cc1nc2ccc(OCc3ccccc3)cc2c(=O)n1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H18N2O4/c1-15-24-21-12-11-19(29-14-16-5-3-2-4-6-16)13-20(21)22(26)25(15)18-9-7-17(8-10-18)23(27)28/h2-13H,14H2,1H3,(H,27,28) |
| InChIKey | IGRYFDGXDLWAIQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |