C25H23N3O3 — CID 46415784
N-[[4-(methoxymethyl)phenyl]methyl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide (PubChem CID 46415784) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)phenyl]methyl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide.
| Compound Name | N-[[4-(methoxymethyl)phenyl]methyl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide |
|---|---|
| PubChem CID | 46415784 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-[[4-(methoxymethyl)phenyl]methyl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide |
| SMILES | COCc1ccc(CNC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C25H23N3O3/c1-17-27-23-6-4-3-5-22(23)25(30)28(17)21-13-11-20(12-14-21)24(29)26-15-18-7-9-19(10-8-18)16-31-2/h3-14H,15-16H2,1-2H3,(H,26,29) |
| InChIKey | HARRHMRJRLPYPU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |