C24H21N5O2S — CID 35785421
1-benzyl-3-[[4-(2-methyl-4-oxoquinazolin-3-yl)benzoyl]amino]thiourea (PubChem CID 35785421) has the molecular formula C24H21N5O2S and a molecular weight of 443.53 g/mol. Its IUPAC name is 1-benzyl-3-[[4-(2-methyl-4-oxoquinazolin-3-yl)benzoyl]amino]thiourea.
| Compound Name | 1-benzyl-3-[[4-(2-methyl-4-oxoquinazolin-3-yl)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 35785421 |
| Molecular Formula | C24H21N5O2S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 1-benzyl-3-[[4-(2-methyl-4-oxoquinazolin-3-yl)benzoyl]amino]thiourea |
| SMILES | Cc1nc2ccccc2c(=O)n1-c1ccc(C(=O)NNC(=S)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N5O2S/c1-16-26-21-10-6-5-9-20(21)23(31)29(16)19-13-11-18(12-14-19)22(30)27-28-24(32)25-15-17-7-3-2-4-8-17/h2-14H,15H2,1H3,(H,27,30)(H2,25,28,32) |
| InChIKey | VIVZBUPSCVWYGH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|