C23H18F8N2 — CID 166668823
2-fluoro-4-[[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]methyl]benzonitrile (PubChem CID 166668823) has the molecular formula C23H18F8N2 and a molecular weight of 474.40 g/mol. Its IUPAC name is 2-fluoro-4-[[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]methyl]benzonitrile.
| Compound Name | 2-fluoro-4-[[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 166668823 |
| Molecular Formula | C23H18F8N2 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 2-fluoro-4-[[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCC3c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CCC32)cc1F |
| InChI | InChI=1S/C23H18F8N2/c24-19-9-13(1-2-15(19)11-32)12-33-8-7-18-17-5-4-16(10-14(17)3-6-20(18)33)21(25,22(26,27)28)23(29,30)31/h1-2,4-5,9-10,18,20H,3,6-8,12H2 |
| InChIKey | IFSVVOALYBCANH-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |