C17H18N4 — CID 166669211
2-[2-(1H-indazol-6-yl)ethyl]-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 166669211) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-[2-(1H-indazol-6-yl)ethyl]-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 2-[2-(1H-indazol-6-yl)ethyl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 166669211 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[2-(1H-indazol-6-yl)ethyl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | c1cnc2c(c1)CCC(CCc1ccc3cn[nH]c3c1)N2 |
| InChI | InChI=1S/C17H18N4/c1-2-13-6-8-15(20-17(13)18-9-1)7-4-12-3-5-14-11-19-21-16(14)10-12/h1-3,5,9-11,15H,4,6-8H2,(H,18,20)(H,19,21) |
| InChIKey | PYMOIHNDRYTNMT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |