C21H32F2O — CID 166669721
3-(difluoromethoxy)-2-(4,5-dimethylhex-5-en-2-yl)-1-(4-methylpent-1-en-2-yl)cyclohexa-1,3-diene (PubChem CID 166669721) has the molecular formula C21H32F2O and a molecular weight of 338.48 g/mol. Its IUPAC name is 3-(difluoromethoxy)-2-(4,5-dimethylhex-5-en-2-yl)-1-(4-methylpent-1-en-2-yl)cyclohexa-1,3-diene.
| Compound Name | 3-(difluoromethoxy)-2-(4,5-dimethylhex-5-en-2-yl)-1-(4-methylpent-1-en-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 166669721 |
| Molecular Formula | C21H32F2O |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 3-(difluoromethoxy)-2-(4,5-dimethylhex-5-en-2-yl)-1-(4-methylpent-1-en-2-yl)cyclohexa-1,3-diene |
| SMILES | C=C(CC(C)C)C1=C(C(C)CC(C)C(=C)C)C(OC(F)F)=CCC1 |
| InChI | InChI=1S/C21H32F2O/c1-13(2)11-16(6)18-9-8-10-19(24-21(22)23)20(18)17(7)12-15(5)14(3)4/h10,13,15,17,21H,3,6,8-9,11-12H2,1-2,4-5,7H3 |
| InChIKey | WGVHDFBMMVACIP-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|