C26H33NO4 — CID 166672882
1-[(4R,4aR,6S,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-methoxy-4a-[(E)-prop-1-enyl]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]ethanone (PubChem CID 166672882) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is 1-[(4R,4aR,6S,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-methoxy-4a-[(E)-prop-1-enyl]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]ethanone.
| Compound Name | 1-[(4R,4aR,6S,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-methoxy-4a-[(E)-prop-1-enyl]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]ethanone |
|---|---|
| PubChem CID | 166672882 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 1-[(4R,4aR,6S,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-7-methoxy-4a-[(E)-prop-1-enyl]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]ethanone |
| SMILES | C/C=C/[C@]12C[C@H](C(C)=O)C(OC)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(CC1CC1)[C@@H]2C5 |
| InChI | InChI=1S/C26H33NO4/c1-4-9-25-13-18(15(2)28)22(30-3)24-26(25)10-11-27(14-16-5-6-16)20(25)12-17-7-8-19(29)23(31-24)21(17)26/h4,7-9,16,18,20,22,24,29H,5-6,10-14H2,1-3H3/b9-4+/t18-,20-,22?,24+,25-,26+/m1/s1 |
| InChIKey | MZGXVGFPZAGWFM-DNXKBQJJSA-N |
| XLogP | 3.62 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|