C31H45NO4 — CID 166672902
(2S)-2-[(4R,4aR,6S,7aR,12bS)-3-(cyclopropylmethyl)-7,9-dimethoxy-4a-[(E)-prop-1-enyl]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]-3,3-dimethylbutan-2-ol (PubChem CID 166672902) has the molecular formula C31H45NO4 and a molecular weight of 495.70 g/mol. Its IUPAC name is (2S)-2-[(4R,4aR,6S,7aR,12bS)-3-(cyclopropylmethyl)-7,9-dimethoxy-4a-[(E)-prop-1-enyl]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]-3,3-dimethylbutan-2-ol.
| Compound Name | (2S)-2-[(4R,4aR,6S,7aR,12bS)-3-(cyclopropylmethyl)-7,9-dimethoxy-4a-[(E)-prop-1-enyl]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 166672902 |
| Molecular Formula | C31H45NO4 |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | (2S)-2-[(4R,4aR,6S,7aR,12bS)-3-(cyclopropylmethyl)-7,9-dimethoxy-4a-[(E)-prop-1-enyl]-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-6-yl]-3,3-dimethylbutan-2-ol |
| SMILES | C/C=C/[C@]12C[C@H]([C@](C)(O)C(C)(C)C)C(OC)[C@@H]3Oc4c(OC)ccc5c4[C@@]31CCN(CC1CC1)[C@@H]2C5 |
| InChI | InChI=1S/C31H45NO4/c1-8-13-30-17-21(29(5,33)28(2,3)4)25(35-7)27-31(30)14-15-32(18-19-9-10-19)23(30)16-20-11-12-22(34-6)26(36-27)24(20)31/h8,11-13,19,21,23,25,27,33H,9-10,14-18H2,1-7H3/b13-8+/t21-,23+,25?,27-,29-,30+,31-/m0/s1 |
| InChIKey | PPNSMMPUCZSSBO-HEYBOYKDSA-N |
| XLogP | 5.13 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|