C34H43ClN2O6S — CID 166673653
(24E)-10-chloro-23-hydroxy-29,29-dioxo-28-(oxolan-2-ylmethyl)-5-oxa-29λ6-thia-17,30-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaen-31-one (PubChem CID 166673653) has the molecular formula C34H43ClN2O6S and a molecular weight of 643.25 g/mol. Its IUPAC name is (24E)-10-chloro-23-hydroxy-29,29-dioxo-28-(oxolan-2-ylmethyl)-5-oxa-29λ6-thia-17,30-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaen-31-one.
| Compound Name | (24E)-10-chloro-23-hydroxy-29,29-dioxo-28-(oxolan-2-ylmethyl)-5-oxa-29λ6-thia-17,30-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaen-31-one |
|---|---|
| PubChem CID | 166673653 |
| Molecular Formula | C34H43ClN2O6S |
| Molecular Weight | 643.25 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | (24E)-10-chloro-23-hydroxy-29,29-dioxo-28-(oxolan-2-ylmethyl)-5-oxa-29λ6-thia-17,30-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaen-31-one |
| SMILES | O=C1NS(=O)(=O)C(CC2CCCO2)CC/C=C\C(O)C2CCC2CN2CCCCc3cc(Cl)ccc3COc3ccc1cc32 |
| InChI | InChI=1S/C34H43ClN2O6S/c35-27-13-10-26-22-43-33-15-12-24-19-31(33)37(16-4-3-6-23(26)18-27)21-25-11-14-30(25)32(38)9-2-1-8-29(20-28-7-5-17-42-28)44(40,41)36-34(24)39/h2,9-10,12-13,15,18-19,25,28-30,32,38H,1,3-8,11,14,16-17,20-22H2,(H,36,39)/b9-2- |
| InChIKey | XZZVOMMSKSNMSO-MBXJOHMKSA-N |
| XLogP | 5.80 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.25 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|