C30H37ClN2O5S — CID 166674752
(19R,22R,23S,24E,27R)-10-chloro-27-ethyl-23-hydroxy-28,28-dioxo-5-oxa-28λ6-thia-17,29-diazapentacyclo[15.13.2.04,32.07,12.019,22]dotriaconta-1(31),2,4(32),7(12),8,10,24-heptaen-30-one (PubChem CID 166674752) has the molecular formula C30H37ClN2O5S and a molecular weight of 573.16 g/mol. Its IUPAC name is (19R,22R,23S,24E,27R)-10-chloro-27-ethyl-23-hydroxy-28,28-dioxo-5-oxa-28λ6-thia-17,29-diazapentacyclo[15.13.2.04,32.07,12.019,22]dotriaconta-1(31),2,4(32),7(12),8,10,24-heptaen-30-one.
| Compound Name | (19R,22R,23S,24E,27R)-10-chloro-27-ethyl-23-hydroxy-28,28-dioxo-5-oxa-28λ6-thia-17,29-diazapentacyclo[15.13.2.04,32.07,12.019,22]dotriaconta-1(31),2,4(32),7(12),8,10,24-heptaen-30-one |
|---|---|
| PubChem CID | 166674752 |
| Molecular Formula | C30H37ClN2O5S |
| Molecular Weight | 573.16 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | (19R,22R,23S,24E,27R)-10-chloro-27-ethyl-23-hydroxy-28,28-dioxo-5-oxa-28λ6-thia-17,29-diazapentacyclo[15.13.2.04,32.07,12.019,22]dotriaconta-1(31),2,4(32),7(12),8,10,24-heptaen-30-one |
| SMILES | CC[C@@H]1C/C=C\[C@H](O)[C@@H]2CC[C@H]2CN2CCCCc3cc(Cl)ccc3COc3ccc(cc32)C(=O)NS1(=O)=O |
| InChI | InChI=1S/C30H37ClN2O5S/c1-2-25-7-5-8-28(34)26-13-10-22(26)18-33-15-4-3-6-20-16-24(31)12-9-23(20)19-38-29-14-11-21(17-27(29)33)30(35)32-39(25,36)37/h5,8-9,11-12,14,16-17,22,25-26,28,34H,2-4,6-7,10,13,15,18-19H2,1H3,(H,32,35)/b8-5-/t22-,25+,26+,28-/m0/s1 |
| InChIKey | SKGFOHULDWCSPE-ZSRSCCOGSA-N |
| XLogP | 5.25 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.16 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|